C13H14N4O2S — CID 23412137
propyl 4-[(3-sulfanylidene-2H-1,2,4-triazin-5-yl)amino]benzoate (PubChem CID 23412137) has the molecular formula C13H14N4O2S and a molecular weight of 290.35 g/mol. Its IUPAC name is propyl 4-[(3-sulfanylidene-2H-1,2,4-triazin-5-yl)amino]benzoate.
| Compound Name | propyl 4-[(3-sulfanylidene-2H-1,2,4-triazin-5-yl)amino]benzoate |
|---|---|
| PubChem CID | 23412137 |
| Molecular Formula | C13H14N4O2S |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | propyl 4-[(3-sulfanylidene-2H-1,2,4-triazin-5-yl)amino]benzoate |
| SMILES | CCCOC(=O)c1ccc(Nc2cn[nH]c(=S)n2)cc1 |
| InChI | InChI=1S/C13H14N4O2S/c1-2-7-19-12(18)9-3-5-10(6-4-9)15-11-8-14-17-13(20)16-11/h3-6,8H,2,7H2,1H3,(H2,15,16,17,20) |
| InChIKey | WEJKPJWMLMFRNS-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|