C13H10N4S — CID 23412159
5-(naphthalen-1-ylamino)-2H-1,2,4-triazine-3-thione (PubChem CID 23412159) has the molecular formula C13H10N4S and a molecular weight of 254.32 g/mol. Its IUPAC name is 5-(naphthalen-1-ylamino)-2H-1,2,4-triazine-3-thione.
| Compound Name | 5-(naphthalen-1-ylamino)-2H-1,2,4-triazine-3-thione |
|---|---|
| PubChem CID | 23412159 |
| Molecular Formula | C13H10N4S |
| Molecular Weight | 254.32 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | 5-(naphthalen-1-ylamino)-2H-1,2,4-triazine-3-thione |
| SMILES | S=c1nc(Nc2cccc3ccccc23)cn[nH]1 |
| InChI | InChI=1S/C13H10N4S/c18-13-16-12(8-14-17-13)15-11-7-3-5-9-4-1-2-6-10(9)11/h1-8H,(H2,15,16,17,18) |
| InChIKey | WWJDKJZNWCMHFC-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.32 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|