C16H20NO2P — CID 23413425
N,N-dimethyl-1-[(4-methylphenyl)-phenoxyphosphoryl]methanamine (PubChem CID 23413425) has the molecular formula C16H20NO2P and a molecular weight of 289.31 g/mol. Its IUPAC name is N,N-dimethyl-1-[(4-methylphenyl)-phenoxyphosphoryl]methanamine.
| Compound Name | N,N-dimethyl-1-[(4-methylphenyl)-phenoxyphosphoryl]methanamine |
|---|---|
| PubChem CID | 23413425 |
| Molecular Formula | C16H20NO2P |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | N,N-dimethyl-1-[(4-methylphenyl)-phenoxyphosphoryl]methanamine |
| SMILES | Cc1ccc(P(=O)(CN(C)C)Oc2ccccc2)cc1 |
| InChI | InChI=1S/C16H20NO2P/c1-14-9-11-16(12-10-14)20(18,13-17(2)3)19-15-7-5-4-6-8-15/h4-12H,13H2,1-3H3 |
| InChIKey | ZLDVHDNAXGVKHJ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|