C32H36P2S2 — CID 23415993
1-diphenylphosphinothioyloctan-3-yl-diphenyl-sulfanylidene-λ5-phosphane (PubChem CID 23415993) has the molecular formula C32H36P2S2 and a molecular weight of 546.72 g/mol. Its IUPAC name is 1-diphenylphosphinothioyloctan-3-yl-diphenyl-sulfanylidene-λ5-phosphane.
| Compound Name | 1-diphenylphosphinothioyloctan-3-yl-diphenyl-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 23415993 |
| Molecular Formula | C32H36P2S2 |
| Molecular Weight | 546.72 g/mol |
| Exact Mass | 546.17 |
| IUPAC Name | 1-diphenylphosphinothioyloctan-3-yl-diphenyl-sulfanylidene-λ5-phosphane |
| SMILES | CCCCCC(CCP(=S)(c1ccccc1)c1ccccc1)P(=S)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H36P2S2/c1-2-3-8-21-32(34(36,30-22-13-6-14-23-30)31-24-15-7-16-25-31)26-27-33(35,28-17-9-4-10-18-28)29-19-11-5-12-20-29/h4-7,9-20,22-25,32H,2-3,8,21,26-27H2,1H3 |
| InChIKey | VSBALGONMSJNHV-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.72 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|