C23H24F3O6P — CID 23420747
[(R)-bis(prop-2-enoxy)phosphoryl-[3-(trifluoromethyl)phenyl]methyl] (2S)-2-methoxy-2-phenylacetate (PubChem CID 23420747) has the molecular formula C23H24F3O6P and a molecular weight of 484.41 g/mol. Its IUPAC name is [(R)-bis(prop-2-enoxy)phosphoryl-[3-(trifluoromethyl)phenyl]methyl] (2S)-2-methoxy-2-phenylacetate.
| Compound Name | [(R)-bis(prop-2-enoxy)phosphoryl-[3-(trifluoromethyl)phenyl]methyl] (2S)-2-methoxy-2-phenylacetate |
|---|---|
| PubChem CID | 23420747 |
| Molecular Formula | C23H24F3O6P |
| Molecular Weight | 484.41 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | [(R)-bis(prop-2-enoxy)phosphoryl-[3-(trifluoromethyl)phenyl]methyl] (2S)-2-methoxy-2-phenylacetate |
| SMILES | C=CCOP(=O)(OCC=C)[C@@H](OC(=O)[C@@H](OC)c1ccccc1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H24F3O6P/c1-4-14-30-33(28,31-15-5-2)22(18-12-9-13-19(16-18)23(24,25)26)32-21(27)20(29-3)17-10-7-6-8-11-17/h4-13,16,20,22H,1-2,14-15H2,3H3/t20-,22+/m0/s1 |
| InChIKey | LYQJJIAECMKXIF-RBBKRZOGSA-N |
| XLogP | 6.23 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.41 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|