About CID 23421237
CID 23421237 (PubChem CID 23421237) has the molecular formula C36H24N5O8P3S2
and a molecular weight of 811.67 g/mol.
Molecular Properties
| Compound Name | CID 23421237 |
| PubChem CID | 23421237 |
| Molecular Formula | C36H24N5O8P3S2 |
| Molecular Weight | 811.67 g/mol |
| Exact Mass | 811.03 |
| IUPAC Name | — |
| SMILES | O=[N+]([O-])c1ccc(SP2(Sc3ccc([N+](=O)[O-])cc3)=NP3(=NP4(=N2)Oc2ccccc2-c2ccccc2O4)Oc2ccccc2-c2ccccc2O3)cc1 |
| InChI | InChI=1S/C36H24N5O8P3S2/c42-40(43)25-17-21-27(22-18-25)53-52(54-28-23-19-26(20-24-28)41(44)45)38-50(46-33-13-5-1-9-29(33)30-10-2-6-14-34(30)47-50)37-51(39-52)48-35-15-7-3-11-31(35)32-12-4-8-16-36(32)49-51/h1-24H |
| InChIKey | IYWQXEJWJUNUDS-UHFFFAOYSA-N |
| XLogP | 13.52 |
| TPSA | 160.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 811.67 |
| LogP ≤ 5 | 13.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 23421237 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 23421237?
The IUPAC name of CID 23421237 (CID 23421237) is not available.
What is the SMILES notation for CID 23421237?
The canonical SMILES for CID 23421237 is O=[N+]([O-])c1ccc(SP2(Sc3ccc([N+](=O)[O-])cc3)=NP3(=NP4(=N2)Oc2ccccc2-c2ccccc2O4)Oc2ccccc2-c2ccccc2O3)cc1.
What is the InChIKey of CID 23421237?
The InChIKey is IYWQXEJWJUNUDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H24N5O8P3S2/c42-40(43)25-17-21-27(22-18-25)53-52(54-28-23-19-26(20-24-28)41(44)45)38-50(46-33-13-5-1-9-29(33)30-10-2-6-14-34(30)47-50)37-51(39-52)48-35-15-7-3-11-31(35)32-12-4-8-16-36(32)49-51/h1-24H.
What are the key properties of CID 23421237?
CID 23421237 has a molecular weight of 811.67 g/mol, XLogP of 13.52, 6 rotatable bonds, 0 hydrogen bond donors, and 13 hydrogen bond acceptors.
Where does this data come from?
All data for CID 23421237 is sourced from PubChem (CID 23421237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).