C19H26O5 — CID 23425466
[(1S,3S,8S,9Z,10aS)-8-acetyloxy-1,9,10a-trimethyl-7-oxo-1,2,3,5,6,8-hexahydrobenzo[8]annulen-3-yl] acetate (PubChem CID 23425466) has the molecular formula C19H26O5 and a molecular weight of 334.41 g/mol. Its IUPAC name is [(1S,3S,8S,9Z,10aS)-8-acetyloxy-1,9,10a-trimethyl-7-oxo-1,2,3,5,6,8-hexahydrobenzo[8]annulen-3-yl] acetate.
| Compound Name | [(1S,3S,8S,9Z,10aS)-8-acetyloxy-1,9,10a-trimethyl-7-oxo-1,2,3,5,6,8-hexahydrobenzo[8]annulen-3-yl] acetate |
|---|---|
| PubChem CID | 23425466 |
| Molecular Formula | C19H26O5 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | [(1S,3S,8S,9Z,10aS)-8-acetyloxy-1,9,10a-trimethyl-7-oxo-1,2,3,5,6,8-hexahydrobenzo[8]annulen-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C=C2CCC(=O)[C@@H](OC(C)=O)/C(C)=C\[C@]2(C)[C@@H](C)C1 |
| InChI | InChI=1S/C19H26O5/c1-11-10-19(5)12(2)8-16(23-13(3)20)9-15(19)6-7-17(22)18(11)24-14(4)21/h9-10,12,16,18H,6-8H2,1-5H3/b11-10-/t12-,16-,18-,19+/m0/s1 |
| InChIKey | DSAQEKCHLYCMIR-OBOQMHEISA-N |
| XLogP | 3.13 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|