C15H22O2 — CID 23426971
2-[(E,2S)-6-hydroxy-6-methylhept-4-en-2-yl]-5-methylphenol (PubChem CID 23426971) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is 2-[(E,2S)-6-hydroxy-6-methylhept-4-en-2-yl]-5-methylphenol.
| Compound Name | 2-[(E,2S)-6-hydroxy-6-methylhept-4-en-2-yl]-5-methylphenol |
|---|---|
| PubChem CID | 23426971 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | 2-[(E,2S)-6-hydroxy-6-methylhept-4-en-2-yl]-5-methylphenol |
| SMILES | Cc1ccc([C@@H](C)C/C=C/C(C)(C)O)c(O)c1 |
| InChI | InChI=1S/C15H22O2/c1-11-7-8-13(14(16)10-11)12(2)6-5-9-15(3,4)17/h5,7-10,12,16-17H,6H2,1-4H3/b9-5+/t12-/m0/s1 |
| InChIKey | SZEQTNGHLUJJGQ-LHXVZLOVSA-N |
| XLogP | 3.52 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|