C15H22O — CID 162868571
(E,6R)-2-methyl-6-(4-methylphenyl)hept-3-en-2-ol (PubChem CID 162868571) has the molecular formula C15H22O and a molecular weight of 218.34 g/mol. Its IUPAC name is (E,6R)-2-methyl-6-(4-methylphenyl)hept-3-en-2-ol.
| Compound Name | (E,6R)-2-methyl-6-(4-methylphenyl)hept-3-en-2-ol |
|---|---|
| PubChem CID | 162868571 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | (E,6R)-2-methyl-6-(4-methylphenyl)hept-3-en-2-ol |
| SMILES | Cc1ccc([C@H](C)C/C=C/C(C)(C)O)cc1 |
| InChI | InChI=1S/C15H22O/c1-12-7-9-14(10-8-12)13(2)6-5-11-15(3,4)16/h5,7-11,13,16H,6H2,1-4H3/b11-5+/t13-/m1/s1 |
| InChIKey | FCWODWIUPFWVDN-HQIZRNBFSA-N |
| XLogP | 3.82 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|