C17H28O — CID 126614779
(6S)-4-ethyl-2-methyl-6-(4-methylphenyl)heptan-2-ol (PubChem CID 126614779) has the molecular formula C17H28O and a molecular weight of 248.41 g/mol. Its IUPAC name is (6S)-4-ethyl-2-methyl-6-(4-methylphenyl)heptan-2-ol.
| Compound Name | (6S)-4-ethyl-2-methyl-6-(4-methylphenyl)heptan-2-ol |
|---|---|
| PubChem CID | 126614779 |
| Molecular Formula | C17H28O |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.21 |
| IUPAC Name | (6S)-4-ethyl-2-methyl-6-(4-methylphenyl)heptan-2-ol |
| SMILES | CCC(C[C@H](C)c1ccc(C)cc1)CC(C)(C)O |
| InChI | InChI=1S/C17H28O/c1-6-15(12-17(4,5)18)11-14(3)16-9-7-13(2)8-10-16/h7-10,14-15,18H,6,11-12H2,1-5H3/t14-,15?/m0/s1 |
| InChIKey | IKEBJKXEWAEFAP-MLCCFXAWSA-N |
| XLogP | 4.68 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |