C19H26O4 — CID 23427927
methyl (6Z,9E,11E,13E)-9-formyl-15-oxoheptadeca-6,9,11,13-tetraenoate (PubChem CID 23427927) has the molecular formula C19H26O4 and a molecular weight of 318.41 g/mol. Its IUPAC name is methyl (6Z,9E,11E,13E)-9-formyl-15-oxoheptadeca-6,9,11,13-tetraenoate.
| Compound Name | methyl (6Z,9E,11E,13E)-9-formyl-15-oxoheptadeca-6,9,11,13-tetraenoate |
|---|---|
| PubChem CID | 23427927 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | methyl (6Z,9E,11E,13E)-9-formyl-15-oxoheptadeca-6,9,11,13-tetraenoate |
| SMILES | CCC(=O)/C=C/C=C/C=C(/C=O)C/C=C\CCCCC(=O)OC |
| InChI | InChI=1S/C19H26O4/c1-3-18(21)14-10-7-9-13-17(16-20)12-8-5-4-6-11-15-19(22)23-2/h5,7-10,13-14,16H,3-4,6,11-12,15H2,1-2H3/b8-5-,9-7+,14-10+,17-13+ |
| InChIKey | YMUSIXKANAAQHB-QYZXUUGCSA-N |
| XLogP | 3.88 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|