C28H30N4O4S2 — CID 23428905
ethyl 1-[5-cyano-1,4-dimethyl-6-oxo-3-[(E)-[4-oxo-3-(1-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-pyridinyl]piperidine-3-carboxylate (PubChem CID 23428905) has the molecular formula C28H30N4O4S2 and a molecular weight of 550.71 g/mol. Its IUPAC name is ethyl 1-[5-cyano-1,4-dimethyl-6-oxo-3-[(E)-[4-oxo-3-(1-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-pyridinyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[5-cyano-1,4-dimethyl-6-oxo-3-[(E)-[4-oxo-3-(1-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-pyridinyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 23428905 |
| Molecular Formula | C28H30N4O4S2 |
| Molecular Weight | 550.71 g/mol |
| Exact Mass | 550.17 |
| IUPAC Name | ethyl 1-[5-cyano-1,4-dimethyl-6-oxo-3-[(E)-[4-oxo-3-(1-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-pyridinyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(c2c(/C=C3/SC(=S)N(C(C)c4ccccc4)C3=O)c(C)c(C#N)c(=O)n2C)C1 |
| InChI | InChI=1S/C28H30N4O4S2/c1-5-36-27(35)20-12-9-13-31(16-20)24-21(17(2)22(15-29)25(33)30(24)4)14-23-26(34)32(28(37)38-23)18(3)19-10-7-6-8-11-19/h6-8,10-11,14,18,20H,5,9,12-13,16H2,1-4H3/b23-14+ |
| InChIKey | SQZVMPZCANRFOC-OEAKJJBVSA-N |
| XLogP | 4.31 |
| TPSA | 95.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.71 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|