C27H36N4O4S2 — CID 5266864
ethyl 1-[3-[(3-butan-2-yl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-1-butyl-5-cyano-4-methyl-6-oxo-2-pyridinyl]piperidine-3-carboxylate (PubChem CID 5266864) has the molecular formula C27H36N4O4S2 and a molecular weight of 544.74 g/mol. Its IUPAC name is ethyl 1-[3-[(3-butan-2-yl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-1-butyl-5-cyano-4-methyl-6-oxo-2-pyridinyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[3-[(3-butan-2-yl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-1-butyl-5-cyano-4-methyl-6-oxo-2-pyridinyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 5266864 |
| Molecular Formula | C27H36N4O4S2 |
| Molecular Weight | 544.74 g/mol |
| Exact Mass | 544.22 |
| IUPAC Name | ethyl 1-[3-[(3-butan-2-yl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-1-butyl-5-cyano-4-methyl-6-oxo-2-pyridinyl]piperidine-3-carboxylate |
| SMILES | CCCCn1c(N2CCCC(C(=O)OCC)C2)c(C=C2SC(=S)N(C(C)CC)C2=O)c(C)c(C#N)c1=O |
| InChI | InChI=1S/C27H36N4O4S2/c1-6-9-13-30-23(29-12-10-11-19(16-29)26(34)35-8-3)20(18(5)21(15-28)24(30)32)14-22-25(33)31(17(4)7-2)27(36)37-22/h14,17,19H,6-13,16H2,1-5H3 |
| InChIKey | GJDKMEUEMRFNML-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 95.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.74 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|