C30H34N4O4S2 — CID 6316898
ethyl 1-[5-cyano-4-methyl-6-oxo-3-[(Z)-[4-oxo-3-(1-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-1-propyl-2-pyridinyl]piperidine-3-carboxylate (PubChem CID 6316898) has the molecular formula C30H34N4O4S2 and a molecular weight of 578.76 g/mol. Its IUPAC name is ethyl 1-[5-cyano-4-methyl-6-oxo-3-[(Z)-[4-oxo-3-(1-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-1-propyl-2-pyridinyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[5-cyano-4-methyl-6-oxo-3-[(Z)-[4-oxo-3-(1-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-1-propyl-2-pyridinyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 6316898 |
| Molecular Formula | C30H34N4O4S2 |
| Molecular Weight | 578.76 g/mol |
| Exact Mass | 578.20 |
| IUPAC Name | ethyl 1-[5-cyano-4-methyl-6-oxo-3-[(Z)-[4-oxo-3-(1-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-1-propyl-2-pyridinyl]piperidine-3-carboxylate |
| SMILES | CCCn1c(N2CCCC(C(=O)OCC)C2)c(/C=C2\SC(=S)N(C(C)c3ccccc3)C2=O)c(C)c(C#N)c1=O |
| InChI | InChI=1S/C30H34N4O4S2/c1-5-14-33-26(32-15-10-13-22(18-32)29(37)38-6-2)23(19(3)24(17-31)27(33)35)16-25-28(36)34(30(39)40-25)20(4)21-11-8-7-9-12-21/h7-9,11-12,16,20,22H,5-6,10,13-15,18H2,1-4H3/b25-16- |
| InChIKey | YMVJXQISTWRXSQ-XYGWBWBKSA-N |
| XLogP | 5.18 |
| TPSA | 95.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.76 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|