C24H28N4O6S3 — CID 23428938
ethyl 1-[5-cyano-3-[(E)-[3-(1,1-dioxothiolan-3-yl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-1,4-dimethyl-6-oxo-2-pyridinyl]piperidine-4-carboxylate (PubChem CID 23428938) has the molecular formula C24H28N4O6S3 and a molecular weight of 564.71 g/mol. Its IUPAC name is ethyl 1-[5-cyano-3-[(E)-[3-(1,1-dioxothiolan-3-yl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-1,4-dimethyl-6-oxo-2-pyridinyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[5-cyano-3-[(E)-[3-(1,1-dioxothiolan-3-yl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-1,4-dimethyl-6-oxo-2-pyridinyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 23428938 |
| Molecular Formula | C24H28N4O6S3 |
| Molecular Weight | 564.71 g/mol |
| Exact Mass | 564.12 |
| IUPAC Name | ethyl 1-[5-cyano-3-[(E)-[3-(1,1-dioxothiolan-3-yl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-1,4-dimethyl-6-oxo-2-pyridinyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2c(/C=C3/SC(=S)N(C4CCS(=O)(=O)C4)C3=O)c(C)c(C#N)c(=O)n2C)CC1 |
| InChI | InChI=1S/C24H28N4O6S3/c1-4-34-23(31)15-5-8-27(9-6-15)20-17(14(2)18(12-25)21(29)26(20)3)11-19-22(30)28(24(35)36-19)16-7-10-37(32,33)13-16/h11,15-16H,4-10,13H2,1-3H3/b19-11+ |
| InChIKey | RHDVIIRYLKLWKN-YBFXNURJSA-N |
| XLogP | 1.73 |
| TPSA | 129.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.71 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|