C6H13N3 — CID 23435343
N,1-dimethylpiperazin-2-imine (PubChem CID 23435343) has the molecular formula C6H13N3 and a molecular weight of 127.19 g/mol. Its IUPAC name is N,1-dimethylpiperazin-2-imine.
| Compound Name | N,1-dimethylpiperazin-2-imine |
|---|---|
| PubChem CID | 23435343 |
| Molecular Formula | C6H13N3 |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.11 |
| IUPAC Name | N,1-dimethylpiperazin-2-imine |
| SMILES | C/N=C1\CNCCN1C |
| InChI | InChI=1S/C6H13N3/c1-7-6-5-8-3-4-9(6)2/h8H,3-5H2,1-2H3/b7-6+ |
| InChIKey | GCGNODZNYQJHJS-VOTSOKGWSA-N |
| XLogP | -0.45 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|