C16H24N2O3 — CID 23437760
N-hydroxy-3-methyl-2-[methyl-(2-methyl-2-phenylpropanoyl)amino]butanamide (PubChem CID 23437760) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is N-hydroxy-3-methyl-2-[methyl-(2-methyl-2-phenylpropanoyl)amino]butanamide.
| Compound Name | N-hydroxy-3-methyl-2-[methyl-(2-methyl-2-phenylpropanoyl)amino]butanamide |
|---|---|
| PubChem CID | 23437760 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | N-hydroxy-3-methyl-2-[methyl-(2-methyl-2-phenylpropanoyl)amino]butanamide |
| SMILES | CC(C)C(C(=O)NO)N(C)C(=O)C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C16H24N2O3/c1-11(2)13(14(19)17-21)18(5)15(20)16(3,4)12-9-7-6-8-10-12/h6-11,13,21H,1-5H3,(H,17,19) |
| InChIKey | YMLGYVLDJPTTSA-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|