C22H23ClN6O — CID 23438711
N-(6-chloro-3-pyridinyl)-2-[[piperidin-4-yl(pyridin-4-yl)methyl]amino]pyridine-3-carboxamide (PubChem CID 23438711) has the molecular formula C22H23ClN6O and a molecular weight of 422.92 g/mol. Its IUPAC name is N-(6-chloro-3-pyridinyl)-2-[[piperidin-4-yl(pyridin-4-yl)methyl]amino]pyridine-3-carboxamide.
| Compound Name | N-(6-chloro-3-pyridinyl)-2-[[piperidin-4-yl(pyridin-4-yl)methyl]amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 23438711 |
| Molecular Formula | C22H23ClN6O |
| Molecular Weight | 422.92 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | N-(6-chloro-3-pyridinyl)-2-[[piperidin-4-yl(pyridin-4-yl)methyl]amino]pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)nc1)c1cccnc1NC(c1ccncc1)C1CCNCC1 |
| InChI | InChI=1S/C22H23ClN6O/c23-19-4-3-17(14-27-19)28-22(30)18-2-1-9-26-21(18)29-20(15-5-10-24-11-6-15)16-7-12-25-13-8-16/h1-6,9-11,14,16,20,25H,7-8,12-13H2,(H,26,29)(H,28,30) |
| InChIKey | KBGHOQARXIKZRZ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.92 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|