C14H19N5 — CID 23440219
3-N-[(2,5-diaminophenyl)methyl]-3-N-methylbenzene-1,2,3-triamine (PubChem CID 23440219) has the molecular formula C14H19N5 and a molecular weight of 257.34 g/mol. Its IUPAC name is 3-N-[(2,5-diaminophenyl)methyl]-3-N-methylbenzene-1,2,3-triamine.
| Compound Name | 3-N-[(2,5-diaminophenyl)methyl]-3-N-methylbenzene-1,2,3-triamine |
|---|---|
| PubChem CID | 23440219 |
| Molecular Formula | C14H19N5 |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | 3-N-[(2,5-diaminophenyl)methyl]-3-N-methylbenzene-1,2,3-triamine |
| SMILES | CN(Cc1cc(N)ccc1N)c1cccc(N)c1N |
| InChI | InChI=1S/C14H19N5/c1-19(13-4-2-3-12(17)14(13)18)8-9-7-10(15)5-6-11(9)16/h2-7H,8,15-18H2,1H3 |
| InChIKey | NNMNEQDFTWVYOE-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 107.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|