C17H15BrN2O2 — CID 23444477
2-[1-(4-bromophenyl)ethylamino]-5-methyl-3,1-benzoxazin-4-one (PubChem CID 23444477) has the molecular formula C17H15BrN2O2 and a molecular weight of 359.22 g/mol. Its IUPAC name is 2-[1-(4-bromophenyl)ethylamino]-5-methyl-3,1-benzoxazin-4-one.
| Compound Name | 2-[1-(4-bromophenyl)ethylamino]-5-methyl-3,1-benzoxazin-4-one |
|---|---|
| PubChem CID | 23444477 |
| Molecular Formula | C17H15BrN2O2 |
| Molecular Weight | 359.22 g/mol |
| Exact Mass | 358.03 |
| IUPAC Name | 2-[1-(4-bromophenyl)ethylamino]-5-methyl-3,1-benzoxazin-4-one |
| SMILES | Cc1cccc2nc(NC(C)c3ccc(Br)cc3)oc(=O)c12 |
| InChI | InChI=1S/C17H15BrN2O2/c1-10-4-3-5-14-15(10)16(21)22-17(20-14)19-11(2)12-6-8-13(18)9-7-12/h3-9,11H,1-2H3,(H,19,20) |
| InChIKey | IBEVHLOERUNRSM-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.22 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |