C15H14BrN3O — CID 79890343
2-N-[1-(4-bromophenyl)ethyl]-1,3-benzoxazole-2,5-diamine (PubChem CID 79890343) has the molecular formula C15H14BrN3O and a molecular weight of 332.20 g/mol. Its IUPAC name is 2-N-[1-(4-bromophenyl)ethyl]-1,3-benzoxazole-2,5-diamine.
| Compound Name | 2-N-[1-(4-bromophenyl)ethyl]-1,3-benzoxazole-2,5-diamine |
|---|---|
| PubChem CID | 79890343 |
| Molecular Formula | C15H14BrN3O |
| Molecular Weight | 332.20 g/mol |
| Exact Mass | 331.03 |
| IUPAC Name | 2-N-[1-(4-bromophenyl)ethyl]-1,3-benzoxazole-2,5-diamine |
| SMILES | CC(Nc1nc2cc(N)ccc2o1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H14BrN3O/c1-9(10-2-4-11(16)5-3-10)18-15-19-13-8-12(17)6-7-14(13)20-15/h2-9H,17H2,1H3,(H,18,19) |
| InChIKey | FCLHRHNAXJEPRE-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.20 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|