C20H28N7O4S+ — CID 23446318
[3-[4-[[5-(1-aminoethyl)-2-methoxy-6-methyl-3-pyridinyl]amino]piperazin-1-yl]-5-nitrophenyl]-methylsulfanyl-oxoazanium (PubChem CID 23446318) has the molecular formula C20H28N7O4S+ and a molecular weight of 462.56 g/mol. Its IUPAC name is [3-[4-[[5-(1-aminoethyl)-2-methoxy-6-methyl-3-pyridinyl]amino]piperazin-1-yl]-5-nitrophenyl]-methylsulfanyl-oxoazanium.
| Compound Name | [3-[4-[[5-(1-aminoethyl)-2-methoxy-6-methyl-3-pyridinyl]amino]piperazin-1-yl]-5-nitrophenyl]-methylsulfanyl-oxoazanium |
|---|---|
| PubChem CID | 23446318 |
| Molecular Formula | C20H28N7O4S+ |
| Molecular Weight | 462.56 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | [3-[4-[[5-(1-aminoethyl)-2-methoxy-6-methyl-3-pyridinyl]amino]piperazin-1-yl]-5-nitrophenyl]-methylsulfanyl-oxoazanium |
| SMILES | COc1nc(C)c(C(C)N)cc1NN1CCN(c2cc([N+](=O)[O-])cc([N+](=O)SC)c2)CC1 |
| InChI | InChI=1S/C20H28N7O4S/c1-13(21)18-12-19(20(31-3)22-14(18)2)23-25-7-5-24(6-8-25)15-9-16(26(28)29)11-17(10-15)27(30)32-4/h9-13,23H,5-8,21H2,1-4H3/q+1 |
| InChIKey | NFIJWMXSOQQYBR-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 129.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.56 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|