C21H21N7O6 — CID 86588089
4-(3,5-dinitrophenyl)-N-(3-methoxyquinoxalin-2-yl)-N-methylpiperazine-1-carboxamide (PubChem CID 86588089) has the molecular formula C21H21N7O6 and a molecular weight of 467.44 g/mol. Its IUPAC name is 4-(3,5-dinitrophenyl)-N-(3-methoxyquinoxalin-2-yl)-N-methylpiperazine-1-carboxamide.
| Compound Name | 4-(3,5-dinitrophenyl)-N-(3-methoxyquinoxalin-2-yl)-N-methylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 86588089 |
| Molecular Formula | C21H21N7O6 |
| Molecular Weight | 467.44 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | 4-(3,5-dinitrophenyl)-N-(3-methoxyquinoxalin-2-yl)-N-methylpiperazine-1-carboxamide |
| SMILES | COc1nc2ccccc2nc1N(C)C(=O)N1CCN(c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C21H21N7O6/c1-24(19-20(34-2)23-18-6-4-3-5-17(18)22-19)21(29)26-9-7-25(8-10-26)14-11-15(27(30)31)13-16(12-14)28(32)33/h3-6,11-13H,7-10H2,1-2H3 |
| InChIKey | ZCPYBOCXPSVCOO-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 148.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.44 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|