C26H28Cl2N4O4S — CID 23447518
4-(6-chloronaphthalen-2-yl)sulfonyl-1-[[4-(morpholine-4-carboximidoyl)phenyl]methyl]piperazin-2-one;hydrochloride (PubChem CID 23447518) has the molecular formula C26H28Cl2N4O4S and a molecular weight of 563.51 g/mol. Its IUPAC name is 4-(6-chloronaphthalen-2-yl)sulfonyl-1-[[4-(morpholine-4-carboximidoyl)phenyl]methyl]piperazin-2-one;hydrochloride.
| Compound Name | 4-(6-chloronaphthalen-2-yl)sulfonyl-1-[[4-(morpholine-4-carboximidoyl)phenyl]methyl]piperazin-2-one;hydrochloride |
|---|---|
| PubChem CID | 23447518 |
| Molecular Formula | C26H28Cl2N4O4S |
| Molecular Weight | 563.51 g/mol |
| Exact Mass | 562.12 |
| IUPAC Name | 4-(6-chloronaphthalen-2-yl)sulfonyl-1-[[4-(morpholine-4-carboximidoyl)phenyl]methyl]piperazin-2-one;hydrochloride |
| SMILES | Cl.[H]/N=C(/c1ccc(CN2CCN(S(=O)(=O)c3ccc4cc(Cl)ccc4c3)CC2=O)cc1)N1CCOCC1 |
| InChI | InChI=1S/C26H27ClN4O4S.ClH/c27-23-7-5-22-16-24(8-6-21(22)15-23)36(33,34)31-10-9-30(25(32)18-31)17-19-1-3-20(4-2-19)26(28)29-11-13-35-14-12-29;/h1-8,15-16,28H,9-14,17-18H2;1H/b28-26-; |
| InChIKey | SAVLSCVWBKYVRO-QVLVYXDLSA-N |
| XLogP | 3.61 |
| TPSA | 94.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.51 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|