C22H24N6O3S — CID 23447463
4-[[4-[4-(imidazol-1-ylmethyl)phenyl]sulfonyl-2-oxopiperazin-1-yl]methyl]benzenecarboximidamide (PubChem CID 23447463) has the molecular formula C22H24N6O3S and a molecular weight of 452.54 g/mol. Its IUPAC name is 4-[[4-[4-(imidazol-1-ylmethyl)phenyl]sulfonyl-2-oxopiperazin-1-yl]methyl]benzenecarboximidamide.
| Compound Name | 4-[[4-[4-(imidazol-1-ylmethyl)phenyl]sulfonyl-2-oxopiperazin-1-yl]methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 23447463 |
| Molecular Formula | C22H24N6O3S |
| Molecular Weight | 452.54 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | 4-[[4-[4-(imidazol-1-ylmethyl)phenyl]sulfonyl-2-oxopiperazin-1-yl]methyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(CN2CCN(S(=O)(=O)c3ccc(Cn4ccnc4)cc3)CC2=O)cc1 |
| InChI | InChI=1S/C22H24N6O3S/c23-22(24)19-5-1-18(2-6-19)14-27-11-12-28(15-21(27)29)32(30,31)20-7-3-17(4-8-20)13-26-10-9-25-16-26/h1-10,16H,11-15H2,(H3,23,24) |
| InChIKey | GYVTUKVZSHRJJF-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 125.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.54 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|