C22H30N6O3S — CID 23447530
1-[(1-ethanimidoylpiperidin-4-yl)methyl]-4-[4-(imidazol-1-ylmethyl)phenyl]sulfonylpiperazin-2-one (PubChem CID 23447530) has the molecular formula C22H30N6O3S and a molecular weight of 458.59 g/mol. Its IUPAC name is 1-[(1-ethanimidoylpiperidin-4-yl)methyl]-4-[4-(imidazol-1-ylmethyl)phenyl]sulfonylpiperazin-2-one.
| Compound Name | 1-[(1-ethanimidoylpiperidin-4-yl)methyl]-4-[4-(imidazol-1-ylmethyl)phenyl]sulfonylpiperazin-2-one |
|---|---|
| PubChem CID | 23447530 |
| Molecular Formula | C22H30N6O3S |
| Molecular Weight | 458.59 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | 1-[(1-ethanimidoylpiperidin-4-yl)methyl]-4-[4-(imidazol-1-ylmethyl)phenyl]sulfonylpiperazin-2-one |
| SMILES | [H]/N=C(\C)N1CCC(CN2CCN(S(=O)(=O)c3ccc(Cn4ccnc4)cc3)CC2=O)CC1 |
| InChI | InChI=1S/C22H30N6O3S/c1-18(23)26-9-6-20(7-10-26)15-27-12-13-28(16-22(27)29)32(30,31)21-4-2-19(3-5-21)14-25-11-8-24-17-25/h2-5,8,11,17,20,23H,6-7,9-10,12-16H2,1H3/b23-18+ |
| InChIKey | XHJVFLOVOVMRFX-PTGBLXJZSA-N |
| XLogP | 1.47 |
| TPSA | 102.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.59 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|