C14H8F2I2O3 — CID 23450772
4-[fluoro-(2-fluorophenyl)methoxy]-3,5-diiodobenzoic acid (PubChem CID 23450772) has the molecular formula C14H8F2I2O3 and a molecular weight of 516.02 g/mol. Its IUPAC name is 4-[fluoro-(2-fluorophenyl)methoxy]-3,5-diiodobenzoic acid.
| Compound Name | 4-[fluoro-(2-fluorophenyl)methoxy]-3,5-diiodobenzoic acid |
|---|---|
| PubChem CID | 23450772 |
| Molecular Formula | C14H8F2I2O3 |
| Molecular Weight | 516.02 g/mol |
| Exact Mass | 515.85 |
| IUPAC Name | 4-[fluoro-(2-fluorophenyl)methoxy]-3,5-diiodobenzoic acid |
| SMILES | O=C(O)c1cc(I)c(OC(F)c2ccccc2F)c(I)c1 |
| InChI | InChI=1S/C14H8F2I2O3/c15-9-4-2-1-3-8(9)13(16)21-12-10(17)5-7(14(19)20)6-11(12)18/h1-6,13H,(H,19,20) |
| InChIKey | KTHMVBHEXUJFRV-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.02 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|