About 1,1-dichloroethene;ethene
1,1-dichloroethene;ethene (PubChem CID 23453294) has the molecular formula C4H6Cl2
and a molecular weight of 125.00 g/mol. Its IUPAC name is 1,1-dichloroethene;ethene.
Molecular Properties
| Compound Name | 1,1-dichloroethene;ethene |
| PubChem CID | 23453294 |
| Molecular Formula | C4H6Cl2 |
| Molecular Weight | 125.00 g/mol |
| Exact Mass | 123.98 |
| IUPAC Name | 1,1-dichloroethene;ethene |
| SMILES | C=C.C=C(Cl)Cl |
| InChI | InChI=1S/C2H2Cl2.C2H4/c1-2(3)4;1-2/h1H2;1-2H2 |
| InChIKey | DAKDHGSTFGTDCB-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.00 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dichloroethene;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dichloroethene;ethene?
The IUPAC name of 1,1-dichloroethene;ethene (CID 23453294) is 1,1-dichloroethene;ethene.
What is the SMILES notation for 1,1-dichloroethene;ethene?
The canonical SMILES for 1,1-dichloroethene;ethene is C=C.C=C(Cl)Cl.
What is the InChIKey of 1,1-dichloroethene;ethene?
The InChIKey is DAKDHGSTFGTDCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H2Cl2.C2H4/c1-2(3)4;1-2/h1H2;1-2H2.
What are the key properties of 1,1-dichloroethene;ethene?
1,1-dichloroethene;ethene has a molecular weight of 125.00 g/mol, XLogP of 2.74, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dichloroethene;ethene is sourced from PubChem (CID 23453294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).