About 1,1-dichloroethene;ethene;trihydrochloride
1,1-dichloroethene;ethene;trihydrochloride (PubChem CID 174533171) has the molecular formula C4H9Cl5
and a molecular weight of 234.38 g/mol. Its IUPAC name is 1,1-dichloroethene;ethene;trihydrochloride.
Molecular Properties
| Compound Name | 1,1-dichloroethene;ethene;trihydrochloride |
| PubChem CID | 174533171 |
| Molecular Formula | C4H9Cl5 |
| Molecular Weight | 234.38 g/mol |
| Exact Mass | 231.91 |
| IUPAC Name | 1,1-dichloroethene;ethene;trihydrochloride |
| SMILES | C=C.C=C(Cl)Cl.Cl.Cl.Cl |
| InChI | InChI=1S/C2H2Cl2.C2H4.3ClH/c1-2(3)4;1-2;;;/h1H2;1-2H2;3*1H |
| InChIKey | KNJXBACQDZPZGS-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.38 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dichloroethene;ethene;trihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dichloroethene;ethene;trihydrochloride?
The IUPAC name of 1,1-dichloroethene;ethene;trihydrochloride (CID 174533171) is 1,1-dichloroethene;ethene;trihydrochloride.
What is the SMILES notation for 1,1-dichloroethene;ethene;trihydrochloride?
The canonical SMILES for 1,1-dichloroethene;ethene;trihydrochloride is C=C.C=C(Cl)Cl.Cl.Cl.Cl.
What is the InChIKey of 1,1-dichloroethene;ethene;trihydrochloride?
The InChIKey is KNJXBACQDZPZGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H2Cl2.C2H4.3ClH/c1-2(3)4;1-2;;;/h1H2;1-2H2;3*1H.
What are the key properties of 1,1-dichloroethene;ethene;trihydrochloride?
1,1-dichloroethene;ethene;trihydrochloride has a molecular weight of 234.38 g/mol, XLogP of 4.00, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dichloroethene;ethene;trihydrochloride is sourced from PubChem (CID 174533171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).