C4H8Cl8 — CID 172763855
ethene;1,1,2,2-tetrachloroethene;tetrahydrochloride (PubChem CID 172763855) has the molecular formula C4H8Cl8 and a molecular weight of 339.73 g/mol. Its IUPAC name is ethene;1,1,2,2-tetrachloroethene;tetrahydrochloride.
| Compound Name | ethene;1,1,2,2-tetrachloroethene;tetrahydrochloride |
|---|---|
| PubChem CID | 172763855 |
| Molecular Formula | C4H8Cl8 |
| Molecular Weight | 339.73 g/mol |
| Exact Mass | 335.81 |
| IUPAC Name | ethene;1,1,2,2-tetrachloroethene;tetrahydrochloride |
| SMILES | C=C.Cl.Cl.Cl.Cl.ClC(Cl)=C(Cl)Cl |
| InChI | InChI=1S/C2Cl4.C2H4.4ClH/c3-1(4)2(5)6;1-2;;;;/h;1-2H2;4*1H |
| InChIKey | MAYBRNWGGLOREM-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.73 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|