C4HCl7 — CID 157094529
1,1,2,3,4,4-hexachlorobuta-1,3-diene;hydrochloride (PubChem CID 157094529) has the molecular formula C4HCl7 and a molecular weight of 297.22 g/mol. Its IUPAC name is 1,1,2,3,4,4-hexachlorobuta-1,3-diene;hydrochloride.
| Compound Name | 1,1,2,3,4,4-hexachlorobuta-1,3-diene;hydrochloride |
|---|---|
| PubChem CID | 157094529 |
| Molecular Formula | C4HCl7 |
| Molecular Weight | 297.22 g/mol |
| Exact Mass | 293.79 |
| IUPAC Name | 1,1,2,3,4,4-hexachlorobuta-1,3-diene;hydrochloride |
| SMILES | Cl.ClC(Cl)=C(Cl)C(Cl)=C(Cl)Cl |
| InChI | InChI=1S/C4Cl6.ClH/c5-1(3(7)8)2(6)4(9)10;/h;1H |
| InChIKey | DYQKLHRZRSYLHK-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.22 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|