C4H2Cl6N2-2 — CID 172819342
1,1,2,2-tetrachloroethene;dicyanide;dihydrochloride (PubChem CID 172819342) has the molecular formula C4H2Cl6N2-2 and a molecular weight of 290.79 g/mol. Its IUPAC name is 1,1,2,2-tetrachloroethene;dicyanide;dihydrochloride.
| Compound Name | 1,1,2,2-tetrachloroethene;dicyanide;dihydrochloride |
|---|---|
| PubChem CID | 172819342 |
| Molecular Formula | C4H2Cl6N2-2 |
| Molecular Weight | 290.79 g/mol |
| Exact Mass | 287.84 |
| IUPAC Name | 1,1,2,2-tetrachloroethene;dicyanide;dihydrochloride |
| SMILES | Cl.Cl.ClC(Cl)=C(Cl)Cl.[C-]#N.[C-]#N |
| InChI | InChI=1S/C2Cl4.2CN.2ClH/c3-1(4)2(5)6;2*1-2;;/h;;;2*1H/q;2*-1;; |
| InChIKey | TZYRPLRSITYABN-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.79 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|