C10H16Cl4 — CID 173095715
ethene;1,1,2,2-tetrachloroethene (PubChem CID 173095715) has the molecular formula C10H16Cl4 and a molecular weight of 278.05 g/mol. Its IUPAC name is ethene;1,1,2,2-tetrachloroethene.
| Compound Name | ethene;1,1,2,2-tetrachloroethene |
|---|---|
| PubChem CID | 173095715 |
| Molecular Formula | C10H16Cl4 |
| Molecular Weight | 278.05 g/mol |
| Exact Mass | 276.00 |
| IUPAC Name | ethene;1,1,2,2-tetrachloroethene |
| SMILES | C=C.C=C.C=C.C=C.ClC(Cl)=C(Cl)Cl |
| InChI | InChI=1S/C2Cl4.4C2H4/c3-1(4)2(5)6;4*1-2/h;4*1-2H2 |
| InChIKey | ZBOGKTMFHKORNC-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.05 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|