C4Cl5NO2 — CID 15185263
(3Z)-1,1,2,3,4-pentachloro-4-nitrobuta-1,3-diene (PubChem CID 15185263) has the molecular formula C4Cl5NO2 and a molecular weight of 271.31 g/mol. Its IUPAC name is (3Z)-1,1,2,3,4-pentachloro-4-nitrobuta-1,3-diene.
| Compound Name | (3Z)-1,1,2,3,4-pentachloro-4-nitrobuta-1,3-diene |
|---|---|
| PubChem CID | 15185263 |
| Molecular Formula | C4Cl5NO2 |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 268.84 |
| IUPAC Name | (3Z)-1,1,2,3,4-pentachloro-4-nitrobuta-1,3-diene |
| SMILES | O=[N+]([O-])/C(Cl)=C(/Cl)C(Cl)=C(Cl)Cl |
| InChI | InChI=1S/C4Cl5NO2/c5-1(3(7)8)2(6)4(9)10(11)12/b4-2+ |
| InChIKey | AGLNPFVCHQHLPB-DUXPYHPUSA-N |
| XLogP | 3.80 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|