C4BrCl4NO2 — CID 131843930
1-bromo-1,3,4,4-tetrachloro-2-nitrobuta-1,3-diene (PubChem CID 131843930) has the molecular formula C4BrCl4NO2 and a molecular weight of 315.77 g/mol. Its IUPAC name is 1-bromo-1,3,4,4-tetrachloro-2-nitrobuta-1,3-diene.
| Compound Name | 1-bromo-1,3,4,4-tetrachloro-2-nitrobuta-1,3-diene |
|---|---|
| PubChem CID | 131843930 |
| Molecular Formula | C4BrCl4NO2 |
| Molecular Weight | 315.77 g/mol |
| Exact Mass | 312.79 |
| IUPAC Name | 1-bromo-1,3,4,4-tetrachloro-2-nitrobuta-1,3-diene |
| SMILES | O=[N+]([O-])C(=C(Cl)Br)C(Cl)=C(Cl)Cl |
| InChI | InChI=1S/C4BrCl4NO2/c5-3(7)2(10(11)12)1(6)4(8)9 |
| InChIKey | XAQRMKANGXHDPW-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.77 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|