C10H4BrCl3N2O4S — CID 15183327
1-[(1E,3E)-4-bromo-1,3,4-trichloro-2-nitrobuta-1,3-dienyl]sulfanyl-4-nitrobenzene (PubChem CID 15183327) has the molecular formula C10H4BrCl3N2O4S and a molecular weight of 434.48 g/mol. Its IUPAC name is 1-[(1E,3E)-4-bromo-1,3,4-trichloro-2-nitrobuta-1,3-dienyl]sulfanyl-4-nitrobenzene.
| Compound Name | 1-[(1E,3E)-4-bromo-1,3,4-trichloro-2-nitrobuta-1,3-dienyl]sulfanyl-4-nitrobenzene |
|---|---|
| PubChem CID | 15183327 |
| Molecular Formula | C10H4BrCl3N2O4S |
| Molecular Weight | 434.48 g/mol |
| Exact Mass | 431.81 |
| IUPAC Name | 1-[(1E,3E)-4-bromo-1,3,4-trichloro-2-nitrobuta-1,3-dienyl]sulfanyl-4-nitrobenzene |
| SMILES | O=[N+]([O-])C(=C(/Cl)Sc1ccc([N+](=O)[O-])cc1)/C(Cl)=C(/Cl)Br |
| InChI | InChI=1S/C10H4BrCl3N2O4S/c11-9(13)7(12)8(16(19)20)10(14)21-6-3-1-5(2-4-6)15(17)18/h1-4H/b9-7-,10-8- |
| InChIKey | OMIUZYNFRYVAHB-XOHWUJONSA-N |
| XLogP | 5.41 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.48 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|