About 4-[(3E)-4-bromo-3,4-dichloro-1-morpholin-4-yl-2-nitrobuta-1,3-dienyl]morpholine
4-[(3E)-4-bromo-3,4-dichloro-1-morpholin-4-yl-2-nitrobuta-1,3-dienyl]morpholine (PubChem CID 3005112) has the molecular formula C12H16BrCl2N3O4
and a molecular weight of 417.09 g/mol. Its IUPAC name is 4-[(3E)-4-bromo-3,4-dichloro-1-morpholin-4-yl-2-nitrobuta-1,3-dienyl]morpholine.
Molecular Properties
| Compound Name | 4-[(3E)-4-bromo-3,4-dichloro-1-morpholin-4-yl-2-nitrobuta-1,3-dienyl]morpholine |
| PubChem CID | 3005112 |
| Molecular Formula | C12H16BrCl2N3O4 |
| Molecular Weight | 417.09 g/mol |
| Exact Mass | 414.97 |
| IUPAC Name | 4-[(3E)-4-bromo-3,4-dichloro-1-morpholin-4-yl-2-nitrobuta-1,3-dienyl]morpholine |
| SMILES | O=[N+]([O-])C(=C(N1CCOCC1)N1CCOCC1)/C(Cl)=C(/Cl)Br |
| InChI | InChI=1S/C12H16BrCl2N3O4/c13-11(15)9(14)10(18(19)20)12(16-1-5-21-6-2-16)17-3-7-22-8-4-17/h1-8H2/b11-9- |
| InChIKey | QYGRCTZLAAEGJX-LUAWRHEFSA-N |
| XLogP | 2.14 |
| TPSA | 68.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.09 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(3E)-4-bromo-3,4-dichloro-1-morpholin-4-yl-2-nitrobuta-1,3-dienyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3E)-4-bromo-3,4-dichloro-1-morpholin-4-yl-2-nitrobuta-1,3-dienyl]morpholine?
The IUPAC name of 4-[(3E)-4-bromo-3,4-dichloro-1-morpholin-4-yl-2-nitrobuta-1,3-dienyl]morpholine (CID 3005112) is 4-[(3E)-4-bromo-3,4-dichloro-1-morpholin-4-yl-2-nitrobuta-1,3-dienyl]morpholine.
What is the SMILES notation for 4-[(3E)-4-bromo-3,4-dichloro-1-morpholin-4-yl-2-nitrobuta-1,3-dienyl]morpholine?
The canonical SMILES for 4-[(3E)-4-bromo-3,4-dichloro-1-morpholin-4-yl-2-nitrobuta-1,3-dienyl]morpholine is O=[N+]([O-])C(=C(N1CCOCC1)N1CCOCC1)/C(Cl)=C(/Cl)Br.
What is the InChIKey of 4-[(3E)-4-bromo-3,4-dichloro-1-morpholin-4-yl-2-nitrobuta-1,3-dienyl]morpholine?
The InChIKey is QYGRCTZLAAEGJX-LUAWRHEFSA-N. The full InChI is InChI=1S/C12H16BrCl2N3O4/c13-11(15)9(14)10(18(19)20)12(16-1-5-21-6-2-16)17-3-7-22-8-4-17/h1-8H2/b11-9-.
What are the key properties of 4-[(3E)-4-bromo-3,4-dichloro-1-morpholin-4-yl-2-nitrobuta-1,3-dienyl]morpholine?
4-[(3E)-4-bromo-3,4-dichloro-1-morpholin-4-yl-2-nitrobuta-1,3-dienyl]morpholine has a molecular weight of 417.09 g/mol, XLogP of 2.14, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3E)-4-bromo-3,4-dichloro-1-morpholin-4-yl-2-nitrobuta-1,3-dienyl]morpholine is sourced from PubChem (CID 3005112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).