C12H16BrCl2N3O4 — CID 3005112
4-[(3E)-4-bromo-3,4-dichloro-1-morpholin-4-yl-2-nitrobuta-1,3-dienyl]morpholine (PubChem CID 3005112) has the molecular formula C12H16BrCl2N3O4 and a molecular weight of 417.09 g/mol. Its IUPAC name is 4-[(3E)-4-bromo-3,4-dichloro-1-morpholin-4-yl-2-nitrobuta-1,3-dienyl]morpholine.
| Compound Name | 4-[(3E)-4-bromo-3,4-dichloro-1-morpholin-4-yl-2-nitrobuta-1,3-dienyl]morpholine |
|---|---|
| PubChem CID | 3005112 |
| Molecular Formula | C12H16BrCl2N3O4 |
| Molecular Weight | 417.09 g/mol |
| Exact Mass | 414.97 |
| IUPAC Name | 4-[(3E)-4-bromo-3,4-dichloro-1-morpholin-4-yl-2-nitrobuta-1,3-dienyl]morpholine |
| SMILES | O=[N+]([O-])C(=C(N1CCOCC1)N1CCOCC1)/C(Cl)=C(/Cl)Br |
| InChI | InChI=1S/C12H16BrCl2N3O4/c13-11(15)9(14)10(18(19)20)12(16-1-5-21-6-2-16)17-3-7-22-8-4-17/h1-8H2/b11-9- |
| InChIKey | QYGRCTZLAAEGJX-LUAWRHEFSA-N |
| XLogP | 2.14 |
| TPSA | 68.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.09 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|