C8H8Cl4N2O3 — CID 6142045
4-[(1Z)-1,3,4,4-tetrachloro-1-nitrobuta-1,3-dien-2-yl]morpholine (PubChem CID 6142045) has the molecular formula C8H8Cl4N2O3 and a molecular weight of 321.98 g/mol. Its IUPAC name is 4-[(1Z)-1,3,4,4-tetrachloro-1-nitrobuta-1,3-dien-2-yl]morpholine.
| Compound Name | 4-[(1Z)-1,3,4,4-tetrachloro-1-nitrobuta-1,3-dien-2-yl]morpholine |
|---|---|
| PubChem CID | 6142045 |
| Molecular Formula | C8H8Cl4N2O3 |
| Molecular Weight | 321.98 g/mol |
| Exact Mass | 319.93 |
| IUPAC Name | 4-[(1Z)-1,3,4,4-tetrachloro-1-nitrobuta-1,3-dien-2-yl]morpholine |
| SMILES | O=[N+]([O-])/C(Cl)=C(\C(Cl)=C(Cl)Cl)N1CCOCC1 |
| InChI | InChI=1S/C8H8Cl4N2O3/c9-5(7(10)11)6(8(12)14(15)16)13-1-3-17-4-2-13/h1-4H2/b8-6+ |
| InChIKey | CLBVOUZCUNLNNN-SOFGYWHQSA-N |
| XLogP | 2.89 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.98 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|