C8H9Cl2NO4 — CID 14143339
(Z)-2,3-dichloro-4-morpholin-4-yl-4-oxobut-2-enoic acid (PubChem CID 14143339) has the molecular formula C8H9Cl2NO4 and a molecular weight of 254.07 g/mol. Its IUPAC name is (Z)-2,3-dichloro-4-morpholin-4-yl-4-oxobut-2-enoic acid.
| Compound Name | (Z)-2,3-dichloro-4-morpholin-4-yl-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 14143339 |
| Molecular Formula | C8H9Cl2NO4 |
| Molecular Weight | 254.07 g/mol |
| Exact Mass | 252.99 |
| IUPAC Name | (Z)-2,3-dichloro-4-morpholin-4-yl-4-oxobut-2-enoic acid |
| SMILES | O=C(O)/C(Cl)=C(/Cl)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C8H9Cl2NO4/c9-5(6(10)8(13)14)7(12)11-1-3-15-4-2-11/h1-4H2,(H,13,14)/b6-5- |
| InChIKey | POVYJMZAJGRPAN-WAYWQWQTSA-N |
| XLogP | 0.62 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.07 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|