About 1-dodecyl-3-methylurea
1-dodecyl-3-methylurea (PubChem CID 23457042) has the molecular formula C14H30N2O
and a molecular weight of 242.41 g/mol. Its IUPAC name is 1-dodecyl-3-methylurea.
Molecular Properties
| Compound Name | 1-dodecyl-3-methylurea |
| PubChem CID | 23457042 |
| Molecular Formula | C14H30N2O |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.24 |
| IUPAC Name | 1-dodecyl-3-methylurea |
| SMILES | CCCCCCCCCCCCNC(=O)NC |
| InChI | InChI=1S/C14H30N2O/c1-3-4-5-6-7-8-9-10-11-12-13-16-14(17)15-2/h3-13H2,1-2H3,(H2,15,16,17) |
| InChIKey | FIGBTDOMBRNSSW-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-dodecyl-3-methylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-dodecyl-3-methylurea?
The IUPAC name of 1-dodecyl-3-methylurea (CID 23457042) is 1-dodecyl-3-methylurea.
What is the SMILES notation for 1-dodecyl-3-methylurea?
The canonical SMILES for 1-dodecyl-3-methylurea is CCCCCCCCCCCCNC(=O)NC.
What is the InChIKey of 1-dodecyl-3-methylurea?
The InChIKey is FIGBTDOMBRNSSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30N2O/c1-3-4-5-6-7-8-9-10-11-12-13-16-14(17)15-2/h3-13H2,1-2H3,(H2,15,16,17).
What are the key properties of 1-dodecyl-3-methylurea?
1-dodecyl-3-methylurea has a molecular weight of 242.41 g/mol, XLogP of 3.84, 11 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-dodecyl-3-methylurea is sourced from PubChem (CID 23457042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).