C18H19ClN2OS — CID 23457675
1-[4-(5-chlorothiophen-2-yl)-2-(2-methylphenoxy)butyl]imidazole (PubChem CID 23457675) has the molecular formula C18H19ClN2OS and a molecular weight of 346.88 g/mol. Its IUPAC name is 1-[4-(5-chlorothiophen-2-yl)-2-(2-methylphenoxy)butyl]imidazole.
| Compound Name | 1-[4-(5-chlorothiophen-2-yl)-2-(2-methylphenoxy)butyl]imidazole |
|---|---|
| PubChem CID | 23457675 |
| Molecular Formula | C18H19ClN2OS |
| Molecular Weight | 346.88 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | 1-[4-(5-chlorothiophen-2-yl)-2-(2-methylphenoxy)butyl]imidazole |
| SMILES | Cc1ccccc1OC(CCc1ccc(Cl)s1)Cn1ccnc1 |
| InChI | InChI=1S/C18H19ClN2OS/c1-14-4-2-3-5-17(14)22-15(12-21-11-10-20-13-21)6-7-16-8-9-18(19)23-16/h2-5,8-11,13,15H,6-7,12H2,1H3 |
| InChIKey | BXTJHCOMAHELAQ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.88 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |