C15H20N2O6 — CID 23458827
1-[4-(2-amino-2-carboxyethyl)-3-methylphenyl]pyrrole-2-carboxylic acid;dihydrate (PubChem CID 23458827) has the molecular formula C15H20N2O6 and a molecular weight of 324.33 g/mol. Its IUPAC name is 1-[4-(2-amino-2-carboxyethyl)-3-methylphenyl]pyrrole-2-carboxylic acid;dihydrate.
| Compound Name | 1-[4-(2-amino-2-carboxyethyl)-3-methylphenyl]pyrrole-2-carboxylic acid;dihydrate |
|---|---|
| PubChem CID | 23458827 |
| Molecular Formula | C15H20N2O6 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 1-[4-(2-amino-2-carboxyethyl)-3-methylphenyl]pyrrole-2-carboxylic acid;dihydrate |
| SMILES | Cc1cc(-n2cccc2C(=O)O)ccc1CC(N)C(=O)O.O.O |
| InChI | InChI=1S/C15H16N2O4.2H2O/c1-9-7-11(17-6-2-3-13(17)15(20)21)5-4-10(9)8-12(16)14(18)19;;/h2-7,12H,8,16H2,1H3,(H,18,19)(H,20,21);2*1H2 |
| InChIKey | UFWYBNVLSZGLHW-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 168.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |