C14H16N2O3 — CID 57018440
(2S)-2-amino-3-[4-hydroxy-3-(2-methylpyrrol-1-yl)phenyl]propanoic acid (PubChem CID 57018440) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is (2S)-2-amino-3-[4-hydroxy-3-(2-methylpyrrol-1-yl)phenyl]propanoic acid.
| Compound Name | (2S)-2-amino-3-[4-hydroxy-3-(2-methylpyrrol-1-yl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 57018440 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | (2S)-2-amino-3-[4-hydroxy-3-(2-methylpyrrol-1-yl)phenyl]propanoic acid |
| SMILES | Cc1cccn1-c1cc(C[C@H](N)C(=O)O)ccc1O |
| InChI | InChI=1S/C14H16N2O3/c1-9-3-2-6-16(9)12-8-10(4-5-13(12)17)7-11(15)14(18)19/h2-6,8,11,17H,7,15H2,1H3,(H,18,19)/t11-/m0/s1 |
| InChIKey | MUCHJHLRGQYHCY-NSHDSACASA-N |
| XLogP | 1.45 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |