C7H20NO5P — CID 23459330
dihydrogen phosphate;2-hydroxyethyl-dimethyl-propylazanium (PubChem CID 23459330) has the molecular formula C7H20NO5P and a molecular weight of 229.21 g/mol. Its IUPAC name is dihydrogen phosphate;2-hydroxyethyl-dimethyl-propylazanium.
| Compound Name | dihydrogen phosphate;2-hydroxyethyl-dimethyl-propylazanium |
|---|---|
| PubChem CID | 23459330 |
| Molecular Formula | C7H20NO5P |
| Molecular Weight | 229.21 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | dihydrogen phosphate;2-hydroxyethyl-dimethyl-propylazanium |
| SMILES | CCC[N+](C)(C)CCO.O=P([O-])(O)O |
| InChI | InChI=1S/C7H18NO.H3O4P/c1-4-5-8(2,3)6-7-9;1-5(2,3)4/h9H,4-7H2,1-3H3;(H3,1,2,3,4)/q+1;/p-1 |
| InChIKey | JFGVSUPVGOCEDG-UHFFFAOYSA-M |
| XLogP | -1.10 |
| TPSA | 100.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.21 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|