C14H13BrCl2N4O3S — CID 23460889
3-[5-[2-bromo-1-(2,4-dichlorophenoxy)ethyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-1-methylimidazolidin-2-one (PubChem CID 23460889) has the molecular formula C14H13BrCl2N4O3S and a molecular weight of 468.16 g/mol. Its IUPAC name is 3-[5-[2-bromo-1-(2,4-dichlorophenoxy)ethyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-1-methylimidazolidin-2-one.
| Compound Name | 3-[5-[2-bromo-1-(2,4-dichlorophenoxy)ethyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-1-methylimidazolidin-2-one |
|---|---|
| PubChem CID | 23460889 |
| Molecular Formula | C14H13BrCl2N4O3S |
| Molecular Weight | 468.16 g/mol |
| Exact Mass | 465.93 |
| IUPAC Name | 3-[5-[2-bromo-1-(2,4-dichlorophenoxy)ethyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-1-methylimidazolidin-2-one |
| SMILES | CN1CC(O)N(c2nnc(C(CBr)Oc3ccc(Cl)cc3Cl)s2)C1=O |
| InChI | InChI=1S/C14H13BrCl2N4O3S/c1-20-6-11(22)21(14(20)23)13-19-18-12(25-13)10(5-15)24-9-3-2-7(16)4-8(9)17/h2-4,10-11,22H,5-6H2,1H3 |
| InChIKey | XXLPHUJCYNBFQK-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.16 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|