C14H30O4S2 — CID 23462762
1-(1,1-diethoxypropyldisulfanyl)-1,1-diethoxypropane (PubChem CID 23462762) has the molecular formula C14H30O4S2 and a molecular weight of 326.52 g/mol. Its IUPAC name is 1-(1,1-diethoxypropyldisulfanyl)-1,1-diethoxypropane.
| Compound Name | 1-(1,1-diethoxypropyldisulfanyl)-1,1-diethoxypropane |
|---|---|
| PubChem CID | 23462762 |
| Molecular Formula | C14H30O4S2 |
| Molecular Weight | 326.52 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | 1-(1,1-diethoxypropyldisulfanyl)-1,1-diethoxypropane |
| SMILES | CCOC(CC)(OCC)SSC(CC)(OCC)OCC |
| InChI | InChI=1S/C14H30O4S2/c1-7-13(15-9-3,16-10-4)19-20-14(8-2,17-11-5)18-12-6/h7-12H2,1-6H3 |
| InChIKey | VFYDRGUSSYFIAC-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.52 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|