C11H11Cl2NO4S — CID 23469430
[2,6-dichloro-4-(methanesulfonamido)phenyl] 2-methylprop-2-enoate (PubChem CID 23469430) has the molecular formula C11H11Cl2NO4S and a molecular weight of 324.19 g/mol. Its IUPAC name is [2,6-dichloro-4-(methanesulfonamido)phenyl] 2-methylprop-2-enoate.
| Compound Name | [2,6-dichloro-4-(methanesulfonamido)phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 23469430 |
| Molecular Formula | C11H11Cl2NO4S |
| Molecular Weight | 324.19 g/mol |
| Exact Mass | 322.98 |
| IUPAC Name | [2,6-dichloro-4-(methanesulfonamido)phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1c(Cl)cc(NS(C)(=O)=O)cc1Cl |
| InChI | InChI=1S/C11H11Cl2NO4S/c1-6(2)11(15)18-10-8(12)4-7(5-9(10)13)14-19(3,16)17/h4-5,14H,1H2,2-3H3 |
| InChIKey | PSHCCUVDDXVKDZ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.19 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|