C10H11NO4 — CID 23469808
4,5,6-trimethylpyridine-2,3-dicarboxylic acid (PubChem CID 23469808) has the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. Its IUPAC name is 4,5,6-trimethylpyridine-2,3-dicarboxylic acid.
| Compound Name | 4,5,6-trimethylpyridine-2,3-dicarboxylic acid |
|---|---|
| PubChem CID | 23469808 |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.20 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 4,5,6-trimethylpyridine-2,3-dicarboxylic acid |
| SMILES | Cc1nc(C(=O)O)c(C(=O)O)c(C)c1C |
| InChI | InChI=1S/C10H11NO4/c1-4-5(2)7(9(12)13)8(10(14)15)11-6(4)3/h1-3H3,(H,12,13)(H,14,15) |
| InChIKey | KAWVRMJMISXNSX-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.20 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |