C14H17NO6 — CID 67620695
5-(1,3-dioxepan-2-yl)-4,6-dimethylpyridine-2,3-dicarboxylic acid (PubChem CID 67620695) has the molecular formula C14H17NO6 and a molecular weight of 295.29 g/mol. Its IUPAC name is 5-(1,3-dioxepan-2-yl)-4,6-dimethylpyridine-2,3-dicarboxylic acid.
| Compound Name | 5-(1,3-dioxepan-2-yl)-4,6-dimethylpyridine-2,3-dicarboxylic acid |
|---|---|
| PubChem CID | 67620695 |
| Molecular Formula | C14H17NO6 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 5-(1,3-dioxepan-2-yl)-4,6-dimethylpyridine-2,3-dicarboxylic acid |
| SMILES | Cc1nc(C(=O)O)c(C(=O)O)c(C)c1C1OCCCCO1 |
| InChI | InChI=1S/C14H17NO6/c1-7-9(14-20-5-3-4-6-21-14)8(2)15-11(13(18)19)10(7)12(16)17/h14H,3-6H2,1-2H3,(H,16,17)(H,18,19) |
| InChIKey | GFMURWMRKCRFHE-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 105.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |