C21H19N3O3 — CID 23469862
[3-(cyclopropylcarbamoylamino)phenyl] N-naphthalen-1-ylcarbamate (PubChem CID 23469862) has the molecular formula C21H19N3O3 and a molecular weight of 361.40 g/mol. Its IUPAC name is [3-(cyclopropylcarbamoylamino)phenyl] N-naphthalen-1-ylcarbamate.
| Compound Name | [3-(cyclopropylcarbamoylamino)phenyl] N-naphthalen-1-ylcarbamate |
|---|---|
| PubChem CID | 23469862 |
| Molecular Formula | C21H19N3O3 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | [3-(cyclopropylcarbamoylamino)phenyl] N-naphthalen-1-ylcarbamate |
| SMILES | O=C(Nc1cccc(OC(=O)Nc2cccc3ccccc23)c1)NC1CC1 |
| InChI | InChI=1S/C21H19N3O3/c25-20(22-15-11-12-15)23-16-7-4-8-17(13-16)27-21(26)24-19-10-3-6-14-5-1-2-9-18(14)19/h1-10,13,15H,11-12H2,(H,24,26)(H2,22,23,25) |
| InChIKey | NMWIMPADYWQVAW-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |